C11H7F14NO3 — CID 91736151
3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91736151) has the molecular formula C11H7F14NO3 and a molecular weight of 467.15 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | 3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91736151 |
| Molecular Formula | C11H7F14NO3 |
| Molecular Weight | 467.15 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | 3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(NCCCOC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H7F14NO3/c12-6(13,8(16,17)10(20,21)22)4(27)26-2-1-3-29-5(28)7(14,15)9(18,19)11(23,24)25/h1-3H2,(H,26,27) |
| InChIKey | DWCOAJWZQZMFTA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.15 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|