About decyl N-heptan-2-ylcarbamate
decyl N-heptan-2-ylcarbamate (PubChem CID 91736331) has the molecular formula C18H37NO2
and a molecular weight of 299.50 g/mol. Its IUPAC name is decyl N-heptan-2-ylcarbamate.
Molecular Properties
| Compound Name | decyl N-heptan-2-ylcarbamate |
| PubChem CID | 91736331 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | decyl N-heptan-2-ylcarbamate |
| SMILES | CCCCCCCCCCOC(=O)NC(C)CCCCC |
| InChI | InChI=1S/C18H37NO2/c1-4-6-8-9-10-11-12-14-16-21-18(20)19-17(3)15-13-7-5-2/h17H,4-16H2,1-3H3,(H,19,20) |
| InChIKey | KIWNUJQLPAGGFD-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decyl N-heptan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl N-heptan-2-ylcarbamate?
The IUPAC name of decyl N-heptan-2-ylcarbamate (CID 91736331) is decyl N-heptan-2-ylcarbamate.
What is the SMILES notation for decyl N-heptan-2-ylcarbamate?
The canonical SMILES for decyl N-heptan-2-ylcarbamate is CCCCCCCCCCOC(=O)NC(C)CCCCC.
What is the InChIKey of decyl N-heptan-2-ylcarbamate?
The InChIKey is KIWNUJQLPAGGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO2/c1-4-6-8-9-10-11-12-14-16-21-18(20)19-17(3)15-13-7-5-2/h17H,4-16H2,1-3H3,(H,19,20).
What are the key properties of decyl N-heptan-2-ylcarbamate?
decyl N-heptan-2-ylcarbamate has a molecular weight of 299.50 g/mol, XLogP of 5.82, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decyl N-heptan-2-ylcarbamate is sourced from PubChem (CID 91736331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).