C13H18F4O4 — CID 91736584
5-O-pent-4-en-2-yl 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate (PubChem CID 91736584) has the molecular formula C13H18F4O4 and a molecular weight of 314.28 g/mol. Its IUPAC name is 5-O-pent-4-en-2-yl 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate.
| Compound Name | 5-O-pent-4-en-2-yl 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
|---|---|
| PubChem CID | 91736584 |
| Molecular Formula | C13H18F4O4 |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 5-O-pent-4-en-2-yl 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
| SMILES | C=CCC(C)OC(=O)CCCC(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H18F4O4/c1-3-5-9(2)21-11(19)7-4-6-10(18)20-8-13(16,17)12(14)15/h3,9,12H,1,4-8H2,2H3 |
| InChIKey | GCPJXUWPHORBRI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|