C16H24FN2O2+ — CID 9173669
(2R)-1-(4-ethylpiperazin-4-ium-1-yl)-2-(2-fluorophenoxy)butan-1-one (PubChem CID 9173669) has the molecular formula C16H24FN2O2+ and a molecular weight of 295.38 g/mol. Its IUPAC name is (2R)-1-(4-ethylpiperazin-4-ium-1-yl)-2-(2-fluorophenoxy)butan-1-one.
| Compound Name | (2R)-1-(4-ethylpiperazin-4-ium-1-yl)-2-(2-fluorophenoxy)butan-1-one |
|---|---|
| PubChem CID | 9173669 |
| Molecular Formula | C16H24FN2O2+ |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (2R)-1-(4-ethylpiperazin-4-ium-1-yl)-2-(2-fluorophenoxy)butan-1-one |
| SMILES | CC[C@@H](Oc1ccccc1F)C(=O)N1CC[NH+](CC)CC1 |
| InChI | InChI=1S/C16H23FN2O2/c1-3-14(21-15-8-6-5-7-13(15)17)16(20)19-11-9-18(4-2)10-12-19/h5-8,14H,3-4,9-12H2,1-2H3/p+1/t14-/m1/s1 |
| InChIKey | MPQMSOBIBBSVJH-CQSZACIVSA-O |
| XLogP | 0.73 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |