C11H4F6O4S — CID 91736861
(2,2,2-trifluoroacetyl) 3-(2,2,2-trifluoroacetyl)sulfanylbenzoate (PubChem CID 91736861) has the molecular formula C11H4F6O4S and a molecular weight of 346.20 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-(2,2,2-trifluoroacetyl)sulfanylbenzoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-(2,2,2-trifluoroacetyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 91736861 |
| Molecular Formula | C11H4F6O4S |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-(2,2,2-trifluoroacetyl)sulfanylbenzoate |
| SMILES | O=C(OC(=O)C(F)(F)F)c1cccc(SC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H4F6O4S/c12-10(13,14)8(19)21-7(18)5-2-1-3-6(4-5)22-9(20)11(15,16)17/h1-4H |
| InChIKey | JARMGXXUBAKYDL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|