About S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate
S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate (PubChem CID 91736891) has the molecular formula C9H4ClF3O2S
and a molecular weight of 268.64 g/mol. Its IUPAC name is S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate.
Molecular Properties
| Compound Name | S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate |
| PubChem CID | 91736891 |
| Molecular Formula | C9H4ClF3O2S |
| Molecular Weight | 268.64 g/mol |
| Exact Mass | 267.96 |
| IUPAC Name | S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate |
| SMILES | O=C(Cl)c1cccc(SC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H4ClF3O2S/c10-7(14)5-2-1-3-6(4-5)16-8(15)9(11,12)13/h1-4H |
| InChIKey | SWCJJWCTMSHJJS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.64 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate?
The IUPAC name of S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate (CID 91736891) is S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate.
What is the SMILES notation for S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate?
The canonical SMILES for S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate is O=C(Cl)c1cccc(SC(=O)C(F)(F)F)c1.
What is the InChIKey of S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate?
The InChIKey is SWCJJWCTMSHJJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4ClF3O2S/c10-7(14)5-2-1-3-6(4-5)16-8(15)9(11,12)13/h1-4H.
What are the key properties of S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate?
S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate has a molecular weight of 268.64 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-carbonochloridoylphenyl) 2,2,2-trifluoroethanethioate is sourced from PubChem (CID 91736891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).