C13H17Cl2NOSi — CID 91737030
4-[(2,4-dichlorophenyl)methoxy-dimethylsilyl]butanenitrile (PubChem CID 91737030) has the molecular formula C13H17Cl2NOSi and a molecular weight of 302.28 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methoxy-dimethylsilyl]butanenitrile.
| Compound Name | 4-[(2,4-dichlorophenyl)methoxy-dimethylsilyl]butanenitrile |
|---|---|
| PubChem CID | 91737030 |
| Molecular Formula | C13H17Cl2NOSi |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methoxy-dimethylsilyl]butanenitrile |
| SMILES | C[Si](C)(CCCC#N)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NOSi/c1-18(2,8-4-3-7-16)17-10-11-5-6-12(14)9-13(11)15/h5-6,9H,3-4,8,10H2,1-2H3 |
| InChIKey | LTFUTABNSYREJK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|