C21H32O4 — CID 91737111
4-O-(2,2-dimethylpentan-3-yl) 1-O-hexyl benzene-1,4-dicarboxylate (PubChem CID 91737111) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 4-O-(2,2-dimethylpentan-3-yl) 1-O-hexyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-(2,2-dimethylpentan-3-yl) 1-O-hexyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91737111 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 4-O-(2,2-dimethylpentan-3-yl) 1-O-hexyl benzene-1,4-dicarboxylate |
| SMILES | CCCCCCOC(=O)c1ccc(C(=O)OC(CC)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H32O4/c1-6-8-9-10-15-24-19(22)16-11-13-17(14-12-16)20(23)25-18(7-2)21(3,4)5/h11-14,18H,6-10,15H2,1-5H3 |
| InChIKey | CBOUFNZHMQHDHG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|