About 1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine
1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine (PubChem CID 91737176) has the molecular formula C13H29NO5
and a molecular weight of 279.38 g/mol. Its IUPAC name is 1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine.
Molecular Properties
| Compound Name | 1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine |
| PubChem CID | 91737176 |
| Molecular Formula | C13H29NO5 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine |
| SMILES | COCCN(CCOC)C(COC)(COC)COC |
| InChI | InChI=1S/C13H29NO5/c1-15-8-6-14(7-9-16-2)13(10-17-3,11-18-4)12-19-5/h6-12H2,1-5H3 |
| InChIKey | OKACOZYDHFXGAS-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine?
The IUPAC name of 1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine (CID 91737176) is 1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine.
What is the SMILES notation for 1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine?
The canonical SMILES for 1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine is COCCN(CCOC)C(COC)(COC)COC.
What is the InChIKey of 1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine?
The InChIKey is OKACOZYDHFXGAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO5/c1-15-8-6-14(7-9-16-2)13(10-17-3,11-18-4)12-19-5/h6-12H2,1-5H3.
What are the key properties of 1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine?
1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine has a molecular weight of 279.38 g/mol, XLogP of 0.26, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethoxy-N,N-bis(2-methoxyethyl)-2-(methoxymethyl)propan-2-amine is sourced from PubChem (CID 91737176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).