C31H44O6 — CID 91737292
5,7-dibutoxy-2-(3,4-dibutoxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 91737292) has the molecular formula C31H44O6 and a molecular weight of 512.69 g/mol. Its IUPAC name is 5,7-dibutoxy-2-(3,4-dibutoxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 5,7-dibutoxy-2-(3,4-dibutoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 91737292 |
| Molecular Formula | C31H44O6 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | 5,7-dibutoxy-2-(3,4-dibutoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | CCCCOc1cc(OCCCC)c2c(c1)OC(c1ccc(OCCCC)c(OCCCC)c1)CC2=O |
| InChI | InChI=1S/C31H44O6/c1-5-9-15-33-24-20-29(36-18-12-8-4)31-25(32)22-27(37-30(31)21-24)23-13-14-26(34-16-10-6-2)28(19-23)35-17-11-7-3/h13-14,19-21,27H,5-12,15-18,22H2,1-4H3 |
| InChIKey | MASFMYYRSLVBSX-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|