C16H8F6O6S — CID 91737351
[4-[4-(2,2,2-trifluoroacetyl)oxyphenyl]sulfonylphenyl] 2,2,2-trifluoroacetate (PubChem CID 91737351) has the molecular formula C16H8F6O6S and a molecular weight of 442.29 g/mol. Its IUPAC name is [4-[4-(2,2,2-trifluoroacetyl)oxyphenyl]sulfonylphenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[4-(2,2,2-trifluoroacetyl)oxyphenyl]sulfonylphenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91737351 |
| Molecular Formula | C16H8F6O6S |
| Molecular Weight | 442.29 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | [4-[4-(2,2,2-trifluoroacetyl)oxyphenyl]sulfonylphenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1ccc(S(=O)(=O)c2ccc(OC(=O)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H8F6O6S/c17-15(18,19)13(23)27-9-1-5-11(6-2-9)29(25,26)12-7-3-10(4-8-12)28-14(24)16(20,21)22/h1-8H |
| InChIKey | OGTZCLWLVATXQO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|