C13H18F7NO3 — CID 91737550
4-methylpentyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate (PubChem CID 91737550) has the molecular formula C13H18F7NO3 and a molecular weight of 369.28 g/mol. Its IUPAC name is 4-methylpentyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate.
| Compound Name | 4-methylpentyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate |
|---|---|
| PubChem CID | 91737550 |
| Molecular Formula | C13H18F7NO3 |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 4-methylpentyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate |
| SMILES | CC(C)CCCOC(=O)CN(C)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H18F7NO3/c1-8(2)5-4-6-24-9(22)7-21(3)10(23)11(14,15)12(16,17)13(18,19)20/h8H,4-7H2,1-3H3 |
| InChIKey | QYZDIFAFDRFMFB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|