C14H20F7NO3 — CID 91737551
heptyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate (PubChem CID 91737551) has the molecular formula C14H20F7NO3 and a molecular weight of 383.30 g/mol. Its IUPAC name is heptyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate.
| Compound Name | heptyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate |
|---|---|
| PubChem CID | 91737551 |
| Molecular Formula | C14H20F7NO3 |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | heptyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate |
| SMILES | CCCCCCCOC(=O)CN(C)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H20F7NO3/c1-3-4-5-6-7-8-25-10(23)9-22(2)11(24)12(15,16)13(17,18)14(19,20)21/h3-9H2,1-2H3 |
| InChIKey | UTHMOGRSMJPFQD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|