C12H16F7NO3 — CID 91737639
pentyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate (PubChem CID 91737639) has the molecular formula C12H16F7NO3 and a molecular weight of 355.25 g/mol. Its IUPAC name is pentyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate.
| Compound Name | pentyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate |
|---|---|
| PubChem CID | 91737639 |
| Molecular Formula | C12H16F7NO3 |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | pentyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate |
| SMILES | CCCCCOC(=O)CN(C)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H16F7NO3/c1-3-4-5-6-23-8(21)7-20(2)9(22)10(13,14)11(15,16)12(17,18)19/h3-7H2,1-2H3 |
| InChIKey | OAZIBCRUEVFOKV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|