C14H12F14O6 — CID 91737749
2-[2-[2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethoxy]ethoxy]ethyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91737749) has the molecular formula C14H12F14O6 and a molecular weight of 542.22 g/mol. Its IUPAC name is 2-[2-[2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethoxy]ethoxy]ethyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | 2-[2-[2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethoxy]ethoxy]ethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91737749 |
| Molecular Formula | C14H12F14O6 |
| Molecular Weight | 542.22 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | 2-[2-[2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethoxy]ethoxy]ethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(OCCOCCOCCOC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F14O6/c15-9(16,11(19,20)13(23,24)25)7(29)33-5-3-31-1-2-32-4-6-34-8(30)10(17,18)12(21,22)14(26,27)28/h1-6H2 |
| InChIKey | RMENOZLMYVQJGN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.22 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|