About decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate
decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate (PubChem CID 91737891) has the molecular formula C25H33F6NO3
and a molecular weight of 509.53 g/mol. Its IUPAC name is decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
| PubChem CID | 91737891 |
| Molecular Formula | C25H33F6NO3 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)C1CCN(C(=O)c2cc(C(F)(F)F)ccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C25H33F6NO3/c1-2-3-4-5-6-7-8-9-16-35-23(34)18-12-14-32(15-13-18)22(33)20-17-19(24(26,27)28)10-11-21(20)25(29,30)31/h10-11,17-18H,2-9,12-16H2,1H3 |
| InChIKey | OPMHEUNIEKWXQX-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate?
The IUPAC name of decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate (CID 91737891) is decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate.
What is the SMILES notation for decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate?
The canonical SMILES for decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate is CCCCCCCCCCOC(=O)C1CCN(C(=O)c2cc(C(F)(F)F)ccc2C(F)(F)F)CC1.
What is the InChIKey of decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate?
The InChIKey is OPMHEUNIEKWXQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33F6NO3/c1-2-3-4-5-6-7-8-9-16-35-23(34)18-12-14-32(15-13-18)22(33)20-17-19(24(26,27)28)10-11-21(20)25(29,30)31/h10-11,17-18H,2-9,12-16H2,1H3.
What are the key properties of decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate?
decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate has a molecular weight of 509.53 g/mol, XLogP of 7.26, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decyl 1-[2,5-bis(trifluoromethyl)benzoyl]piperidine-4-carboxylate is sourced from PubChem (CID 91737891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).