C20H31F5O4 — CID 91738427
1-O-[(E)-dodec-2-enyl] 5-O-(2,2,3,3,3-pentafluoropropyl) pentanedioate (PubChem CID 91738427) has the molecular formula C20H31F5O4 and a molecular weight of 430.45 g/mol. Its IUPAC name is 1-O-[(E)-dodec-2-enyl] 5-O-(2,2,3,3,3-pentafluoropropyl) pentanedioate.
| Compound Name | 1-O-[(E)-dodec-2-enyl] 5-O-(2,2,3,3,3-pentafluoropropyl) pentanedioate |
|---|---|
| PubChem CID | 91738427 |
| Molecular Formula | C20H31F5O4 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 1-O-[(E)-dodec-2-enyl] 5-O-(2,2,3,3,3-pentafluoropropyl) pentanedioate |
| SMILES | CCCCCCCCC/C=C/COC(=O)CCCC(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H31F5O4/c1-2-3-4-5-6-7-8-9-10-11-15-28-17(26)13-12-14-18(27)29-16-19(21,22)20(23,24)25/h10-11H,2-9,12-16H2,1H3/b11-10+ |
| InChIKey | AXSRVOSRPCUWFW-ZHACJKMWSA-N |
| XLogP | 6.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|