C9H5Cl2F2NO4 — CID 91738702
(3-chloro-2-nitrophenyl)methyl 2-chloro-2,2-difluoroacetate (PubChem CID 91738702) has the molecular formula C9H5Cl2F2NO4 and a molecular weight of 300.04 g/mol. Its IUPAC name is (3-chloro-2-nitrophenyl)methyl 2-chloro-2,2-difluoroacetate.
| Compound Name | (3-chloro-2-nitrophenyl)methyl 2-chloro-2,2-difluoroacetate |
|---|---|
| PubChem CID | 91738702 |
| Molecular Formula | C9H5Cl2F2NO4 |
| Molecular Weight | 300.04 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | (3-chloro-2-nitrophenyl)methyl 2-chloro-2,2-difluoroacetate |
| SMILES | O=C(OCc1cccc(Cl)c1[N+](=O)[O-])C(F)(F)Cl |
| InChI | InChI=1S/C9H5Cl2F2NO4/c10-6-3-1-2-5(7(6)14(16)17)4-18-8(15)9(11,12)13/h1-3H,4H2 |
| InChIKey | JISKAOPKQLJDMM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.04 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|