C17H21F5O4 — CID 91738734
1-(1-butoxypropan-2-yloxy)propan-2-yl 2,3,4,5,6-pentafluorobenzoate (PubChem CID 91738734) has the molecular formula C17H21F5O4 and a molecular weight of 384.34 g/mol. Its IUPAC name is 1-(1-butoxypropan-2-yloxy)propan-2-yl 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | 1-(1-butoxypropan-2-yloxy)propan-2-yl 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 91738734 |
| Molecular Formula | C17H21F5O4 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-(1-butoxypropan-2-yloxy)propan-2-yl 2,3,4,5,6-pentafluorobenzoate |
| SMILES | CCCCOCC(C)OCC(C)OC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H21F5O4/c1-4-5-6-24-7-9(2)25-8-10(3)26-17(23)11-12(18)14(20)16(22)15(21)13(11)19/h9-10H,4-8H2,1-3H3 |
| InChIKey | SJACYCMZHNAINQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|