C11H14F5NO — CID 91738774
(Z)-5,5,6,6,6-pentafluoro-4-piperidin-1-ylhex-3-en-2-one (PubChem CID 91738774) has the molecular formula C11H14F5NO and a molecular weight of 271.23 g/mol. Its IUPAC name is (Z)-5,5,6,6,6-pentafluoro-4-piperidin-1-ylhex-3-en-2-one.
| Compound Name | (Z)-5,5,6,6,6-pentafluoro-4-piperidin-1-ylhex-3-en-2-one |
|---|---|
| PubChem CID | 91738774 |
| Molecular Formula | C11H14F5NO |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (Z)-5,5,6,6,6-pentafluoro-4-piperidin-1-ylhex-3-en-2-one |
| SMILES | CC(=O)/C=C(\N1CCCCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F5NO/c1-8(18)7-9(10(12,13)11(14,15)16)17-5-3-2-4-6-17/h7H,2-6H2,1H3/b9-7- |
| InChIKey | VDZWMJOAZKPVQR-CLFYSBASSA-N |
| XLogP | 3.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|