C12H9F14NO3 — CID 91738821
2-[ethyl(2,2,3,3,4,4,4-heptafluorobutanoyl)amino]ethyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91738821) has the molecular formula C12H9F14NO3 and a molecular weight of 481.18 g/mol. Its IUPAC name is 2-[ethyl(2,2,3,3,4,4,4-heptafluorobutanoyl)amino]ethyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | 2-[ethyl(2,2,3,3,4,4,4-heptafluorobutanoyl)amino]ethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91738821 |
| Molecular Formula | C12H9F14NO3 |
| Molecular Weight | 481.18 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | 2-[ethyl(2,2,3,3,4,4,4-heptafluorobutanoyl)amino]ethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CCN(CCOC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F14NO3/c1-2-27(5(28)7(13,14)9(17,18)11(21,22)23)3-4-30-6(29)8(15,16)10(19,20)12(24,25)26/h2-4H2,1H3 |
| InChIKey | JYALDVRITXMSSX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.18 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|