C19H20N6S — CID 9173893
4-[4-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-1,3-thiazol-2-yl]-N,N-dimethylaniline (PubChem CID 9173893) has the molecular formula C19H20N6S and a molecular weight of 364.48 g/mol. Its IUPAC name is 4-[4-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-1,3-thiazol-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[4-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-1,3-thiazol-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 9173893 |
| Molecular Formula | C19H20N6S |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-[4-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-1,3-thiazol-2-yl]-N,N-dimethylaniline |
| SMILES | Cc1cc(-c2csc(-c3ccc(N(C)C)cc3)n2)c(C)n1-c1ncn[nH]1 |
| InChI | InChI=1S/C19H20N6S/c1-12-9-16(13(2)25(12)19-20-11-21-23-19)17-10-26-18(22-17)14-5-7-15(8-6-14)24(3)4/h5-11H,1-4H3,(H,20,21,23) |
| InChIKey | LRTNJYYDSVQFRP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|