C14H32N4Si2 — CID 91738942
N,2-bis[tert-butyl(dimethyl)silyl]-1,2,4-triazol-3-amine (PubChem CID 91738942) has the molecular formula C14H32N4Si2 and a molecular weight of 312.61 g/mol. Its IUPAC name is N,2-bis[tert-butyl(dimethyl)silyl]-1,2,4-triazol-3-amine.
| Compound Name | N,2-bis[tert-butyl(dimethyl)silyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 91738942 |
| Molecular Formula | C14H32N4Si2 |
| Molecular Weight | 312.61 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | N,2-bis[tert-butyl(dimethyl)silyl]-1,2,4-triazol-3-amine |
| SMILES | CC(C)(C)[Si](C)(C)Nc1ncnn1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H32N4Si2/c1-13(2,3)19(7,8)17-12-15-11-16-18(12)20(9,10)14(4,5)6/h11H,1-10H3,(H,15,16,17) |
| InChIKey | GXQLSGIFWWLCQZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|