About butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane
butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane (PubChem CID 91738963) has the molecular formula C22H32O2Si
and a molecular weight of 356.58 g/mol. Its IUPAC name is butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane.
Molecular Properties
| Compound Name | butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane |
| PubChem CID | 91738963 |
| Molecular Formula | C22H32O2Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane |
| SMILES | CCCCO[Si](OC(C)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H32O2Si/c1-6-7-18-23-25(20-14-10-8-11-15-20,21-16-12-9-13-17-21)24-19(2)22(3,4)5/h8-17,19H,6-7,18H2,1-5H3 |
| InChIKey | UFOXQSTZFQMRMX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane?
The IUPAC name of butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane (CID 91738963) is butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane.
What is the SMILES notation for butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane?
The canonical SMILES for butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane is CCCCO[Si](OC(C)C(C)(C)C)(c1ccccc1)c1ccccc1.
What is the InChIKey of butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane?
The InChIKey is UFOXQSTZFQMRMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32O2Si/c1-6-7-18-23-25(20-14-10-8-11-15-20,21-16-12-9-13-17-21)24-19(2)22(3,4)5/h8-17,19H,6-7,18H2,1-5H3.
What are the key properties of butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane?
butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane has a molecular weight of 356.58 g/mol, XLogP of 4.51, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butoxy-(3,3-dimethylbutan-2-yloxy)-diphenylsilane is sourced from PubChem (CID 91738963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).