C8F12S — CID 91739038
1,1,2,2,3,3,4-heptafluoro-4-(2,3,3,4,4-pentafluorocyclobuten-1-yl)sulfanylcyclobutane (PubChem CID 91739038) has the molecular formula C8F12S and a molecular weight of 356.13 g/mol. Its IUPAC name is 1,1,2,2,3,3,4-heptafluoro-4-(2,3,3,4,4-pentafluorocyclobuten-1-yl)sulfanylcyclobutane.
| Compound Name | 1,1,2,2,3,3,4-heptafluoro-4-(2,3,3,4,4-pentafluorocyclobuten-1-yl)sulfanylcyclobutane |
|---|---|
| PubChem CID | 91739038 |
| Molecular Formula | C8F12S |
| Molecular Weight | 356.13 g/mol |
| Exact Mass | 355.95 |
| IUPAC Name | 1,1,2,2,3,3,4-heptafluoro-4-(2,3,3,4,4-pentafluorocyclobuten-1-yl)sulfanylcyclobutane |
| SMILES | FC1=C(SC2(F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8F12S/c9-1-2(4(12,13)3(1,10)11)21-8(20)6(16,17)5(14,15)7(8,18)19 |
| InChIKey | IFFGUKFTHIJXCD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.13 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|