C21H44O2Si — CID 91739041
decoxy-ethenyl-methyl-(2,4,4-trimethylpentoxy)silane (PubChem CID 91739041) has the molecular formula C21H44O2Si and a molecular weight of 356.67 g/mol. Its IUPAC name is decoxy-ethenyl-methyl-(2,4,4-trimethylpentoxy)silane.
| Compound Name | decoxy-ethenyl-methyl-(2,4,4-trimethylpentoxy)silane |
|---|---|
| PubChem CID | 91739041 |
| Molecular Formula | C21H44O2Si |
| Molecular Weight | 356.67 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | decoxy-ethenyl-methyl-(2,4,4-trimethylpentoxy)silane |
| SMILES | C=C[Si](C)(OCCCCCCCCCC)OCC(C)CC(C)(C)C |
| InChI | InChI=1S/C21H44O2Si/c1-8-10-11-12-13-14-15-16-17-22-24(7,9-2)23-19-20(3)18-21(4,5)6/h9,20H,2,8,10-19H2,1,3-7H3 |
| InChIKey | STYDKCZLOSLPTR-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.67 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|