About 10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate
10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate (PubChem CID 91739044) has the molecular formula C20H38O5
and a molecular weight of 358.52 g/mol. Its IUPAC name is 10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate.
Molecular Properties
| Compound Name | 10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate |
| PubChem CID | 91739044 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate |
| SMILES | CCCCCCOC(=O)CCCCCCCCC(=O)OCCOCC |
| InChI | InChI=1S/C20H38O5/c1-3-5-6-13-16-24-19(21)14-11-9-7-8-10-12-15-20(22)25-18-17-23-4-2/h3-18H2,1-2H3 |
| InChIKey | ULVOGQFEZUIETN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate?
The IUPAC name of 10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate (CID 91739044) is 10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate.
What is the SMILES notation for 10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate?
The canonical SMILES for 10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate is CCCCCCOC(=O)CCCCCCCCC(=O)OCCOCC.
What is the InChIKey of 10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate?
The InChIKey is ULVOGQFEZUIETN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O5/c1-3-5-6-13-16-24-19(21)14-11-9-7-8-10-12-15-20(22)25-18-17-23-4-2/h3-18H2,1-2H3.
What are the key properties of 10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate?
10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate has a molecular weight of 358.52 g/mol, XLogP of 4.81, 18 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10-O-(2-ethoxyethyl) 1-O-hexyl decanedioate is sourced from PubChem (CID 91739044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).