C19H32O11 — CID 91739455
methyl 2,4-dimethoxy-3-[(2S,3S,4S,5R,6S)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 91739455) has the molecular formula C19H32O11 and a molecular weight of 436.45 g/mol. Its IUPAC name is methyl 2,4-dimethoxy-3-[(2S,3S,4S,5R,6S)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl 2,4-dimethoxy-3-[(2S,3S,4S,5R,6S)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 91739455 |
| Molecular Formula | C19H32O11 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | methyl 2,4-dimethoxy-3-[(2S,3S,4S,5R,6S)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC[C@@H]1O[C@@H](OC2C(OC)C=C(C(=O)OC)OC2OC)[C@@H](OC)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C19H32O11/c1-21-9-12-13(23-3)15(24-4)16(25-5)19(29-12)30-14-10(22-2)8-11(17(20)26-6)28-18(14)27-7/h8,10,12-16,18-19H,9H2,1-7H3/t10?,12-,13+,14?,15-,16-,18?,19-/m0/s1 |
| InChIKey | HASUIBQWSCXQGZ-CJPMUBFOSA-N |
| XLogP | -0.14 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |