C7H2F10N2S — CID 91739874
4-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-4-(trifluoromethyl)-1,3-thiazol-2-amine (PubChem CID 91739874) has the molecular formula C7H2F10N2S and a molecular weight of 336.15 g/mol. Its IUPAC name is 4-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-4-(trifluoromethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-4-(trifluoromethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 91739874 |
| Molecular Formula | C7H2F10N2S |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 4-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-4-(trifluoromethyl)-1,3-thiazol-2-amine |
| SMILES | NC1=NC(F)(C(F)(F)F)C(=C(C(F)(F)F)C(F)(F)F)S1 |
| InChI | InChI=1S/C7H2F10N2S/c8-4(7(15,16)17)2(20-3(18)19-4)1(5(9,10)11)6(12,13)14/h(H2,18,19) |
| InChIKey | HPIIDCLTGQCNPS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|