C8H8F8O2 — CID 91740244
2,2-dimethyl-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-1,3-dioxolane (PubChem CID 91740244) has the molecular formula C8H8F8O2 and a molecular weight of 288.13 g/mol. Its IUPAC name is 2,2-dimethyl-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-1,3-dioxolane.
| Compound Name | 2,2-dimethyl-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 91740244 |
| Molecular Formula | C8H8F8O2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2,2-dimethyl-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-1,3-dioxolane |
| SMILES | CC1(C)OC(C(F)(F)F)C(C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C8H8F8O2/c1-5(2)17-3(4(18-5)7(11,12)13)6(9,10)8(14,15)16/h3-4H,1-2H3 |
| InChIKey | XQBBYHAUGYVDJK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|