C16H36O2Si — CID 91740252
3,7-dimethyloctan-3-yloxy-dimethyl-(2-methylpropoxy)silane (PubChem CID 91740252) has the molecular formula C16H36O2Si and a molecular weight of 288.55 g/mol. Its IUPAC name is 3,7-dimethyloctan-3-yloxy-dimethyl-(2-methylpropoxy)silane.
| Compound Name | 3,7-dimethyloctan-3-yloxy-dimethyl-(2-methylpropoxy)silane |
|---|---|
| PubChem CID | 91740252 |
| Molecular Formula | C16H36O2Si |
| Molecular Weight | 288.55 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 3,7-dimethyloctan-3-yloxy-dimethyl-(2-methylpropoxy)silane |
| SMILES | CCC(C)(CCCC(C)C)O[Si](C)(C)OCC(C)C |
| InChI | InChI=1S/C16H36O2Si/c1-9-16(6,12-10-11-14(2)3)18-19(7,8)17-13-15(4)5/h14-15H,9-13H2,1-8H3 |
| InChIKey | MLBOJQLYBCRIRF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|