C17H27F5O4 — CID 91740399
1-O-(2-methylhexan-3-yl) 3-O-(2,2,3,3,3-pentafluoropropyl) 2,2-diethylpropanedioate (PubChem CID 91740399) has the molecular formula C17H27F5O4 and a molecular weight of 390.39 g/mol. Its IUPAC name is 1-O-(2-methylhexan-3-yl) 3-O-(2,2,3,3,3-pentafluoropropyl) 2,2-diethylpropanedioate.
| Compound Name | 1-O-(2-methylhexan-3-yl) 3-O-(2,2,3,3,3-pentafluoropropyl) 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91740399 |
| Molecular Formula | C17H27F5O4 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-O-(2-methylhexan-3-yl) 3-O-(2,2,3,3,3-pentafluoropropyl) 2,2-diethylpropanedioate |
| SMILES | CCCC(OC(=O)C(CC)(CC)C(=O)OCC(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C17H27F5O4/c1-6-9-12(11(4)5)26-14(24)15(7-2,8-3)13(23)25-10-16(18,19)17(20,21)22/h11-12H,6-10H2,1-5H3 |
| InChIKey | XBLUODVGWMIYKE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|