About 3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide
3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide (PubChem CID 917404) has the molecular formula C19H20N4O2
and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide.
Molecular Properties
| Compound Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide |
| PubChem CID | 917404 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide |
| SMILES | Cc1cc(C)n(CCC(=O)NN=Cc2c(O)ccc3ccccc23)n1 |
| InChI | InChI=1S/C19H20N4O2/c1-13-11-14(2)23(22-13)10-9-19(25)21-20-12-17-16-6-4-3-5-15(16)7-8-18(17)24/h3-8,11-12,24H,9-10H2,1-2H3,(H,21,25) |
| InChIKey | IOCGUKOUGPGNMV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide?
The IUPAC name of 3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide (CID 917404) is 3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide.
What is the SMILES notation for 3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide?
The canonical SMILES for 3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide is Cc1cc(C)n(CCC(=O)NN=Cc2c(O)ccc3ccccc23)n1.
What is the InChIKey of 3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide?
The InChIKey is IOCGUKOUGPGNMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O2/c1-13-11-14(2)23(22-13)10-9-19(25)21-20-12-17-16-6-4-3-5-15(16)7-8-18(17)24/h3-8,11-12,24H,9-10H2,1-2H3,(H,21,25).
What are the key properties of 3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide?
3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide has a molecular weight of 336.39 g/mol, XLogP of 2.90, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylpyrazol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide is sourced from PubChem (CID 917404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).