C38H48N2O3 — CID 91740462
4-(benzylamino)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxynaphthalene-2-carboxamide (PubChem CID 91740462) has the molecular formula C38H48N2O3 and a molecular weight of 580.81 g/mol. Its IUPAC name is 4-(benzylamino)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxynaphthalene-2-carboxamide.
| Compound Name | 4-(benzylamino)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 91740462 |
| Molecular Formula | C38H48N2O3 |
| Molecular Weight | 580.81 g/mol |
| Exact Mass | 580.37 |
| IUPAC Name | 4-(benzylamino)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxynaphthalene-2-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)c2cc(NCc3ccccc3)c3ccccc3c2O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C38H48N2O3/c1-7-37(3,4)28-20-21-34(32(24-28)38(5,6)8-2)43-23-15-14-22-39-36(42)31-25-33(40-26-27-16-10-9-11-17-27)29-18-12-13-19-30(29)35(31)41/h9-13,16-21,24-25,40-41H,7-8,14-15,22-23,26H2,1-6H3,(H,39,42) |
| InChIKey | NIKJBFJJDBSQNX-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.81 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|