About 6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine
6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine (PubChem CID 91740481) has the molecular formula C16H13Cl2NO
and a molecular weight of 306.19 g/mol. Its IUPAC name is 6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine.
Molecular Properties
| Compound Name | 6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine |
| PubChem CID | 91740481 |
| Molecular Formula | C16H13Cl2NO |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine |
| SMILES | CCC1OC(c2ccccc2Cl)=Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H13Cl2NO/c1-2-15-12-9-10(17)7-8-14(12)19-16(20-15)11-5-3-4-6-13(11)18/h3-9,15H,2H2,1H3 |
| InChIKey | KWOAATMQCLJICP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine?
The IUPAC name of 6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine (CID 91740481) is 6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine.
What is the SMILES notation for 6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine?
The canonical SMILES for 6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine is CCC1OC(c2ccccc2Cl)=Nc2ccc(Cl)cc21.
What is the InChIKey of 6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine?
The InChIKey is KWOAATMQCLJICP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl2NO/c1-2-15-12-9-10(17)7-8-14(12)19-16(20-15)11-5-3-4-6-13(11)18/h3-9,15H,2H2,1H3.
What are the key properties of 6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine?
6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine has a molecular weight of 306.19 g/mol, XLogP of 5.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(2-chlorophenyl)-4-ethyl-4H-3,1-benzoxazine is sourced from PubChem (CID 91740481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).