C21H32F6O4 — CID 91740600
1-O-[(E)-dodec-2-enyl] 5-O-(2,2,3,4,4,4-hexafluorobutyl) pentanedioate (PubChem CID 91740600) has the molecular formula C21H32F6O4 and a molecular weight of 462.47 g/mol. Its IUPAC name is 1-O-[(E)-dodec-2-enyl] 5-O-(2,2,3,4,4,4-hexafluorobutyl) pentanedioate.
| Compound Name | 1-O-[(E)-dodec-2-enyl] 5-O-(2,2,3,4,4,4-hexafluorobutyl) pentanedioate |
|---|---|
| PubChem CID | 91740600 |
| Molecular Formula | C21H32F6O4 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 1-O-[(E)-dodec-2-enyl] 5-O-(2,2,3,4,4,4-hexafluorobutyl) pentanedioate |
| SMILES | CCCCCCCCC/C=C/COC(=O)CCCC(=O)OCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C21H32F6O4/c1-2-3-4-5-6-7-8-9-10-11-15-30-17(28)13-12-14-18(29)31-16-20(23,24)19(22)21(25,26)27/h10-11,19H,2-9,12-16H2,1H3/b11-10+ |
| InChIKey | CDRLFMBPCUGTAH-ZHACJKMWSA-N |
| XLogP | 6.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|