C15H21F7O4 — CID 91740816
1-O-(2,2,3,3,4,4,4-heptafluorobutyl) 4-O-(2-methylhexan-3-yl) butanedioate (PubChem CID 91740816) has the molecular formula C15H21F7O4 and a molecular weight of 398.32 g/mol. Its IUPAC name is 1-O-(2,2,3,3,4,4,4-heptafluorobutyl) 4-O-(2-methylhexan-3-yl) butanedioate.
| Compound Name | 1-O-(2,2,3,3,4,4,4-heptafluorobutyl) 4-O-(2-methylhexan-3-yl) butanedioate |
|---|---|
| PubChem CID | 91740816 |
| Molecular Formula | C15H21F7O4 |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-O-(2,2,3,3,4,4,4-heptafluorobutyl) 4-O-(2-methylhexan-3-yl) butanedioate |
| SMILES | CCCC(OC(=O)CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C15H21F7O4/c1-4-5-10(9(2)3)26-12(24)7-6-11(23)25-8-13(16,17)14(18,19)15(20,21)22/h9-10H,4-8H2,1-3H3 |
| InChIKey | IAWYKDRFTPIBSU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|