C10H4ClF5O2S — CID 91740848
S-(3-carbonochloridoylphenyl) 2,2,3,3,3-pentafluoropropanethioate (PubChem CID 91740848) has the molecular formula C10H4ClF5O2S and a molecular weight of 318.65 g/mol. Its IUPAC name is S-(3-carbonochloridoylphenyl) 2,2,3,3,3-pentafluoropropanethioate.
| Compound Name | S-(3-carbonochloridoylphenyl) 2,2,3,3,3-pentafluoropropanethioate |
|---|---|
| PubChem CID | 91740848 |
| Molecular Formula | C10H4ClF5O2S |
| Molecular Weight | 318.65 g/mol |
| Exact Mass | 317.95 |
| IUPAC Name | S-(3-carbonochloridoylphenyl) 2,2,3,3,3-pentafluoropropanethioate |
| SMILES | O=C(Cl)c1cccc(SC(=O)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H4ClF5O2S/c11-7(17)5-2-1-3-6(4-5)19-8(18)9(12,13)10(14,15)16/h1-4H |
| InChIKey | KAUIESJINPEJGR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.65 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|