C25H38O2Si — CID 91740887
heptan-2-yloxy-(4-methylpentoxy)-diphenylsilane (PubChem CID 91740887) has the molecular formula C25H38O2Si and a molecular weight of 398.66 g/mol. Its IUPAC name is heptan-2-yloxy-(4-methylpentoxy)-diphenylsilane.
| Compound Name | heptan-2-yloxy-(4-methylpentoxy)-diphenylsilane |
|---|---|
| PubChem CID | 91740887 |
| Molecular Formula | C25H38O2Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | heptan-2-yloxy-(4-methylpentoxy)-diphenylsilane |
| SMILES | CCCCCC(C)O[Si](OCCCC(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H38O2Si/c1-5-6-9-16-23(4)27-28(24-17-10-7-11-18-24,25-19-12-8-13-20-25)26-21-14-15-22(2)3/h7-8,10-13,17-20,22-23H,5-6,9,14-16,21H2,1-4H3 |
| InChIKey | CUGGSVSDDJMKPL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|