C20H30O — CID 91741017
(4aR,4bR,10aR)-1,1,4a-trimethyl-7-propan-2-yl-4,4b,5,6,10,10a-hexahydro-3H-phenanthren-2-one (PubChem CID 91741017) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (4aR,4bR,10aR)-1,1,4a-trimethyl-7-propan-2-yl-4,4b,5,6,10,10a-hexahydro-3H-phenanthren-2-one.
| Compound Name | (4aR,4bR,10aR)-1,1,4a-trimethyl-7-propan-2-yl-4,4b,5,6,10,10a-hexahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 91741017 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (4aR,4bR,10aR)-1,1,4a-trimethyl-7-propan-2-yl-4,4b,5,6,10,10a-hexahydro-3H-phenanthren-2-one |
| SMILES | CC(C)C1=CC2=CC[C@H]3C(C)(C)C(=O)CC[C@]3(C)[C@H]2CC1 |
| InChI | InChI=1S/C20H30O/c1-13(2)14-6-8-16-15(12-14)7-9-17-19(3,4)18(21)10-11-20(16,17)5/h7,12-13,16-17H,6,8-11H2,1-5H3/t16-,17-,20+/m0/s1 |
| InChIKey | BOPYLVIBVAFZAH-ABSDTBQOSA-N |
| XLogP | 5.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |