C15H33N5OSi2 — CID 91741518
2-N-[tert-butyl(dimethyl)silyl]-6-[tert-butyl(dimethyl)silyl]oxy-1,3,5-triazine-2,4-diamine (PubChem CID 91741518) has the molecular formula C15H33N5OSi2 and a molecular weight of 355.64 g/mol. Its IUPAC name is 2-N-[tert-butyl(dimethyl)silyl]-6-[tert-butyl(dimethyl)silyl]oxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[tert-butyl(dimethyl)silyl]-6-[tert-butyl(dimethyl)silyl]oxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 91741518 |
| Molecular Formula | C15H33N5OSi2 |
| Molecular Weight | 355.64 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | 2-N-[tert-butyl(dimethyl)silyl]-6-[tert-butyl(dimethyl)silyl]oxy-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)(C)[Si](C)(C)Nc1nc(N)nc(O[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C15H33N5OSi2/c1-14(2,3)22(7,8)20-12-17-11(16)18-13(19-12)21-23(9,10)15(4,5)6/h1-10H3,(H3,16,17,18,19,20) |
| InChIKey | HDHWSRDMQDJUTA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|