C18H40O2Si — CID 91741646
3,7-dimethyloctan-3-yloxy-dimethyl-(4-methylpentoxy)silane (PubChem CID 91741646) has the molecular formula C18H40O2Si and a molecular weight of 316.60 g/mol. Its IUPAC name is 3,7-dimethyloctan-3-yloxy-dimethyl-(4-methylpentoxy)silane.
| Compound Name | 3,7-dimethyloctan-3-yloxy-dimethyl-(4-methylpentoxy)silane |
|---|---|
| PubChem CID | 91741646 |
| Molecular Formula | C18H40O2Si |
| Molecular Weight | 316.60 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | 3,7-dimethyloctan-3-yloxy-dimethyl-(4-methylpentoxy)silane |
| SMILES | CCC(C)(CCCC(C)C)O[Si](C)(C)OCCCC(C)C |
| InChI | InChI=1S/C18H40O2Si/c1-9-18(6,14-10-12-16(2)3)20-21(7,8)19-15-11-13-17(4)5/h16-17H,9-15H2,1-8H3 |
| InChIKey | PSYDZWVCTDXZIF-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|