C23H37O4Si — CID 91741858
Prosta-5,8(12),13-trien-1-oic acid, 15-[(dimethylsilyl)oxy]-9-oxo-, methyl ester, (5Z,13E,15S)- (PubChem CID 91741858) has the molecular formula C23H37O4Si and a molecular weight of 405.63 g/mol.
| Compound Name | Prosta-5,8(12),13-trien-1-oic acid, 15-[(dimethylsilyl)oxy]-9-oxo-, methyl ester, (5Z,13E,15S)- |
|---|---|
| PubChem CID | 91741858 |
| Molecular Formula | C23H37O4Si |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | — |
| SMILES | CCCCC[C@@H](/C=C/C1=C(C/C=C/CCCC(=O)OC)C(=O)CC1)O[Si](C)C |
| InChI | InChI=1S/C23H37O4Si/c1-5-6-9-12-20(27-28(3)4)17-15-19-16-18-22(24)21(19)13-10-7-8-11-14-23(25)26-2/h7,10,15,17,20H,5-6,8-9,11-14,16,18H2,1-4H3/b10-7+,17-15+/t20-/m0/s1 |
| InChIKey | NNXNEJZOZAMMDH-OHLUAGBSSA-N |
| XLogP | 5.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|