C19H11ClF5NO2 — CID 91742053
N-[1-(2-chlorophenyl)-2-oxocyclohex-3-en-1-yl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 91742053) has the molecular formula C19H11ClF5NO2 and a molecular weight of 415.75 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)-2-oxocyclohex-3-en-1-yl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[1-(2-chlorophenyl)-2-oxocyclohex-3-en-1-yl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 91742053 |
| Molecular Formula | C19H11ClF5NO2 |
| Molecular Weight | 415.75 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | N-[1-(2-chlorophenyl)-2-oxocyclohex-3-en-1-yl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(NC1(c2ccccc2Cl)CCC=CC1=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H11ClF5NO2/c20-10-6-2-1-5-9(10)19(8-4-3-7-11(19)27)26-18(28)12-13(21)15(23)17(25)16(24)14(12)22/h1-3,5-7H,4,8H2,(H,26,28) |
| InChIKey | YZMSQPQZFUWKIT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.75 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|