C16H22F8O5 — CID 91742193
4-O-(5-methoxy-3-methylpentan-2-yl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate (PubChem CID 91742193) has the molecular formula C16H22F8O5 and a molecular weight of 446.33 g/mol. Its IUPAC name is 4-O-(5-methoxy-3-methylpentan-2-yl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate.
| Compound Name | 4-O-(5-methoxy-3-methylpentan-2-yl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
|---|---|
| PubChem CID | 91742193 |
| Molecular Formula | C16H22F8O5 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 4-O-(5-methoxy-3-methylpentan-2-yl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
| SMILES | COCCC(C)C(C)OC(=O)CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H22F8O5/c1-9(6-7-27-3)10(2)29-12(26)5-4-11(25)28-8-14(19,20)16(23,24)15(21,22)13(17)18/h9-10,13H,4-8H2,1-3H3 |
| InChIKey | MKJSGFPGCBJTEI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|