C17H22F8O4 — CID 91742200
1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-[(E)-oct-3-en-2-yl] butanedioate (PubChem CID 91742200) has the molecular formula C17H22F8O4 and a molecular weight of 442.34 g/mol. Its IUPAC name is 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-[(E)-oct-3-en-2-yl] butanedioate.
| Compound Name | 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-[(E)-oct-3-en-2-yl] butanedioate |
|---|---|
| PubChem CID | 91742200 |
| Molecular Formula | C17H22F8O4 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-[(E)-oct-3-en-2-yl] butanedioate |
| SMILES | CCCC/C=C/C(C)OC(=O)CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C17H22F8O4/c1-3-4-5-6-7-11(2)29-13(27)9-8-12(26)28-10-15(20,21)17(24,25)16(22,23)14(18)19/h6-7,11,14H,3-5,8-10H2,1-2H3/b7-6+ |
| InChIKey | ILERQSMOPYJWIE-VOTSOKGWSA-N |
| XLogP | 5.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|