C19H42O2Si — CID 91742249
3,7-dimethyloctan-3-yloxy-heptoxy-dimethylsilane (PubChem CID 91742249) has the molecular formula C19H42O2Si and a molecular weight of 330.63 g/mol. Its IUPAC name is 3,7-dimethyloctan-3-yloxy-heptoxy-dimethylsilane.
| Compound Name | 3,7-dimethyloctan-3-yloxy-heptoxy-dimethylsilane |
|---|---|
| PubChem CID | 91742249 |
| Molecular Formula | C19H42O2Si |
| Molecular Weight | 330.63 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | 3,7-dimethyloctan-3-yloxy-heptoxy-dimethylsilane |
| SMILES | CCCCCCCO[Si](C)(C)OC(C)(CC)CCCC(C)C |
| InChI | InChI=1S/C19H42O2Si/c1-8-10-11-12-13-17-20-22(6,7)21-19(5,9-2)16-14-15-18(3)4/h18H,8-17H2,1-7H3 |
| InChIKey | YKHPAWXRTVGNGY-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.63 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|