C25H32Cl2N4O — CID 91742461
N-cyclohexyl-4-[4-[(3,5-dichlorophenyl)diazenyl]-N-ethyl-3-methylanilino]butanamide (PubChem CID 91742461) has the molecular formula C25H32Cl2N4O and a molecular weight of 475.46 g/mol. Its IUPAC name is N-cyclohexyl-4-[4-[(3,5-dichlorophenyl)diazenyl]-N-ethyl-3-methylanilino]butanamide.
| Compound Name | N-cyclohexyl-4-[4-[(3,5-dichlorophenyl)diazenyl]-N-ethyl-3-methylanilino]butanamide |
|---|---|
| PubChem CID | 91742461 |
| Molecular Formula | C25H32Cl2N4O |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | N-cyclohexyl-4-[4-[(3,5-dichlorophenyl)diazenyl]-N-ethyl-3-methylanilino]butanamide |
| SMILES | CCN(CCCC(=O)NC1CCCCC1)c1ccc(/N=N/c2cc(Cl)cc(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C25H32Cl2N4O/c1-3-31(13-7-10-25(32)28-21-8-5-4-6-9-21)23-11-12-24(18(2)14-23)30-29-22-16-19(26)15-20(27)17-22/h11-12,14-17,21H,3-10,13H2,1-2H3,(H,28,32)/b30-29+ |
| InChIKey | PXHYCSKUQIZHOA-QVIHXGFCSA-N |
| XLogP | 7.77 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|