C13H11F6NO2 — CID 91742697
2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)-N-(2,4,5-trimethylphenyl)acetamide (PubChem CID 91742697) has the molecular formula C13H11F6NO2 and a molecular weight of 327.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)-N-(2,4,5-trimethylphenyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)-N-(2,4,5-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 91742697 |
| Molecular Formula | C13H11F6NO2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)-N-(2,4,5-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(N(C(=O)C(F)(F)F)C(=O)C(F)(F)F)cc1C |
| InChI | InChI=1S/C13H11F6NO2/c1-6-4-8(3)9(5-7(6)2)20(10(21)12(14,15)16)11(22)13(17,18)19/h4-5H,1-3H3 |
| InChIKey | CVUIHGKRLVZCOX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |