C16H20F8O4 — CID 91742860
1-O-[(E)-hex-2-enyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate (PubChem CID 91742860) has the molecular formula C16H20F8O4 and a molecular weight of 428.32 g/mol. Its IUPAC name is 1-O-[(E)-hex-2-enyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate.
| Compound Name | 1-O-[(E)-hex-2-enyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
|---|---|
| PubChem CID | 91742860 |
| Molecular Formula | C16H20F8O4 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-O-[(E)-hex-2-enyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
| SMILES | CCC/C=C/COC(=O)CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H20F8O4/c1-2-3-4-5-9-27-11(25)7-6-8-12(26)28-10-14(19,20)16(23,24)15(21,22)13(17)18/h4-5,13H,2-3,6-10H2,1H3/b5-4+ |
| InChIKey | HYVPVZHQLYJKTB-SNAWJCMRSA-N |
| XLogP | 4.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|